C5H6Br2O2 — CID 19839139
1,5-dibromopentane-2,3-dione (PubChem CID 19839139) has the molecular formula C5H6Br2O2 and a molecular weight of 257.91 g/mol. Its IUPAC name is 1,5-dibromopentane-2,3-dione.
| Compound Name | 1,5-dibromopentane-2,3-dione |
|---|---|
| PubChem CID | 19839139 |
| Molecular Formula | C5H6Br2O2 |
| Molecular Weight | 257.91 g/mol |
| Exact Mass | 255.87 |
| IUPAC Name | 1,5-dibromopentane-2,3-dione |
| SMILES | O=C(CBr)C(=O)CCBr |
| InChI | InChI=1S/C5H6Br2O2/c6-2-1-4(8)5(9)3-7/h1-3H2 |
| InChIKey | WLBBMGRMSPHPFB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.91 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|