About sodium 2-phosphonoacetate
sodium 2-phosphonoacetate (PubChem CID 70692044) has the molecular formula C2H4NaO5P
and a molecular weight of 162.01 g/mol. Its IUPAC name is sodium 2-phosphonoacetate.
Molecular Properties
| Compound Name | sodium 2-phosphonoacetate |
| PubChem CID | 70692044 |
| Molecular Formula | C2H4NaO5P |
| Molecular Weight | 162.01 g/mol |
| Exact Mass | 161.97 |
| IUPAC Name | sodium 2-phosphonoacetate |
| SMILES | O=C([O-])CP(=O)(O)O.[Na+] |
| InChI | InChI=1S/C2H5O5P.Na/c3-2(4)1-8(5,6)7;/h1H2,(H,3,4)(H2,5,6,7);/q;+1/p-1 |
| InChIKey | KNBQMQYQYHZXSX-UHFFFAOYSA-M |
| XLogP | -5.08 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.01 |
| LogP ≤ 5 | -5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-phosphonoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-phosphonoacetate?
The IUPAC name of sodium 2-phosphonoacetate (CID 70692044) is sodium 2-phosphonoacetate.
What is the SMILES notation for sodium 2-phosphonoacetate?
The canonical SMILES for sodium 2-phosphonoacetate is O=C([O-])CP(=O)(O)O.[Na+].
What is the InChIKey of sodium 2-phosphonoacetate?
The InChIKey is KNBQMQYQYHZXSX-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H5O5P.Na/c3-2(4)1-8(5,6)7;/h1H2,(H,3,4)(H2,5,6,7);/q;+1/p-1.
What are the key properties of sodium 2-phosphonoacetate?
sodium 2-phosphonoacetate has a molecular weight of 162.01 g/mol, XLogP of -5.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-phosphonoacetate is sourced from PubChem (CID 70692044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).