2-propylpentylphosphonic acid

C8H19O3P — CID 172756070

IUPAC2-propylpentylphosphonic acid
SMILESCCCC(CCC)CP(=O)(O)O
InChIInChI=1S/C8H19O3P/c1-3-5-8(6-4-2)7-12(9,10)11/h8H,3-7H2,1-2H3,(H2,9,10,11)
InChIKeyLARCDEWFLVRSHT-UHFFFAOYSA-N
MW194.21 g/mol
LogP2.38
Rot. Bonds6

About 2-propylpentylphosphonic acid

2-propylpentylphosphonic acid (PubChem CID 172756070) has the molecular formula C8H19O3P and a molecular weight of 194.21 g/mol. Its IUPAC name is 2-propylpentylphosphonic acid.

Molecular Properties

Compound Name2-propylpentylphosphonic acid
PubChem CID172756070
Molecular FormulaC8H19O3P
Molecular Weight194.21 g/mol
Exact Mass194.11
IUPAC Name2-propylpentylphosphonic acid
SMILESCCCC(CCC)CP(=O)(O)O
InChIInChI=1S/C8H19O3P/c1-3-5-8(6-4-2)7-12(9,10)11/h8H,3-7H2,1-2H3,(H2,9,10,11)
InChIKeyLARCDEWFLVRSHT-UHFFFAOYSA-N
XLogP2.38
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.21
LogP ≤ 52.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-propylpentylphosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-propylpentylphosphonic acid?
The IUPAC name of 2-propylpentylphosphonic acid (CID 172756070) is 2-propylpentylphosphonic acid.
What is the SMILES notation for 2-propylpentylphosphonic acid?
The canonical SMILES for 2-propylpentylphosphonic acid is CCCC(CCC)CP(=O)(O)O.
What is the InChIKey of 2-propylpentylphosphonic acid?
The InChIKey is LARCDEWFLVRSHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19O3P/c1-3-5-8(6-4-2)7-12(9,10)11/h8H,3-7H2,1-2H3,(H2,9,10,11).
What are the key properties of 2-propylpentylphosphonic acid?
2-propylpentylphosphonic acid has a molecular weight of 194.21 g/mol, XLogP of 2.38, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylpentylphosphonic acid is sourced from PubChem (CID 172756070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).