About magnesium;hexanoate;bromide
magnesium;hexanoate;bromide (PubChem CID 175219586) has the molecular formula C6H11BrMgO2
and a molecular weight of 219.36 g/mol. Its IUPAC name is magnesium;hexanoate;bromide.
Molecular Properties
| Compound Name | magnesium;hexanoate;bromide |
| PubChem CID | 175219586 |
| Molecular Formula | C6H11BrMgO2 |
| Molecular Weight | 219.36 g/mol |
| Exact Mass | 217.98 |
| IUPAC Name | magnesium;hexanoate;bromide |
| SMILES | CCCCCC(=O)[O-].[Br-].[Mg+2] |
| InChI | InChI=1S/C6H12O2.BrH.Mg/c1-2-3-4-5-6(7)8;;/h2-5H2,1H3,(H,7,8);1H;/q;;+2/p-2 |
| InChIKey | NCEYVQIZXFJKQY-UHFFFAOYSA-L |
| XLogP | -3.06 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.36 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze magnesium;hexanoate;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;hexanoate;bromide?
The IUPAC name of magnesium;hexanoate;bromide (CID 175219586) is magnesium;hexanoate;bromide.
What is the SMILES notation for magnesium;hexanoate;bromide?
The canonical SMILES for magnesium;hexanoate;bromide is CCCCCC(=O)[O-].[Br-].[Mg+2].
What is the InChIKey of magnesium;hexanoate;bromide?
The InChIKey is NCEYVQIZXFJKQY-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H12O2.BrH.Mg/c1-2-3-4-5-6(7)8;;/h2-5H2,1H3,(H,7,8);1H;/q;;+2/p-2.
What are the key properties of magnesium;hexanoate;bromide?
magnesium;hexanoate;bromide has a molecular weight of 219.36 g/mol, XLogP of -3.06, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;hexanoate;bromide is sourced from PubChem (CID 175219586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).