About 2-fluorohexan-1-amine
2-fluorohexan-1-amine (PubChem CID 55288883) has the molecular formula C6H14FN
and a molecular weight of 119.18 g/mol. Its IUPAC name is 2-fluorohexan-1-amine.
Molecular Properties
| Compound Name | 2-fluorohexan-1-amine |
| PubChem CID | 55288883 |
| Molecular Formula | C6H14FN |
| Molecular Weight | 119.18 g/mol |
| Exact Mass | 119.11 |
| IUPAC Name | 2-fluorohexan-1-amine |
| SMILES | CCCCC(F)CN |
| InChI | InChI=1S/C6H14FN/c1-2-3-4-6(7)5-8/h6H,2-5,8H2,1H3 |
| InChIKey | OROGPYMCEJOHOF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluorohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorohexan-1-amine?
The IUPAC name of 2-fluorohexan-1-amine (CID 55288883) is 2-fluorohexan-1-amine.
What is the SMILES notation for 2-fluorohexan-1-amine?
The canonical SMILES for 2-fluorohexan-1-amine is CCCCC(F)CN.
What is the InChIKey of 2-fluorohexan-1-amine?
The InChIKey is OROGPYMCEJOHOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14FN/c1-2-3-4-6(7)5-8/h6H,2-5,8H2,1H3.
What are the key properties of 2-fluorohexan-1-amine?
2-fluorohexan-1-amine has a molecular weight of 119.18 g/mol, XLogP of 1.47, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorohexan-1-amine is sourced from PubChem (CID 55288883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).