C26H44F6O2 — CID 152563114
1-methyl-1-[1,1,1-trifluoro-2-(1-methylcyclohexyl)oxy-3-(trifluoromethyl)undecan-2-yl]oxycyclohexane (PubChem CID 152563114) has the molecular formula C26H44F6O2 and a molecular weight of 502.62 g/mol. Its IUPAC name is 1-methyl-1-[1,1,1-trifluoro-2-(1-methylcyclohexyl)oxy-3-(trifluoromethyl)undecan-2-yl]oxycyclohexane.
| Compound Name | 1-methyl-1-[1,1,1-trifluoro-2-(1-methylcyclohexyl)oxy-3-(trifluoromethyl)undecan-2-yl]oxycyclohexane |
|---|---|
| PubChem CID | 152563114 |
| Molecular Formula | C26H44F6O2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.32 |
| IUPAC Name | 1-methyl-1-[1,1,1-trifluoro-2-(1-methylcyclohexyl)oxy-3-(trifluoromethyl)undecan-2-yl]oxycyclohexane |
| SMILES | CCCCCCCCC(C(F)(F)F)C(OC1(C)CCCCC1)(OC1(C)CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C26H44F6O2/c1-4-5-6-7-8-11-16-21(25(27,28)29)24(26(30,31)32,33-22(2)17-12-9-13-18-22)34-23(3)19-14-10-15-20-23/h21H,4-20H2,1-3H3 |
| InChIKey | YPXKUAWIYFJFAP-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|