C32H51F9O3 — CID 152633194
1-[2-methyl-1,1-bis[[1-(trifluoromethyl)cyclohexyl]oxy]decoxy]-1-(trifluoromethyl)cyclohexane (PubChem CID 152633194) has the molecular formula C32H51F9O3 and a molecular weight of 654.74 g/mol. Its IUPAC name is 1-[2-methyl-1,1-bis[[1-(trifluoromethyl)cyclohexyl]oxy]decoxy]-1-(trifluoromethyl)cyclohexane.
| Compound Name | 1-[2-methyl-1,1-bis[[1-(trifluoromethyl)cyclohexyl]oxy]decoxy]-1-(trifluoromethyl)cyclohexane |
|---|---|
| PubChem CID | 152633194 |
| Molecular Formula | C32H51F9O3 |
| Molecular Weight | 654.74 g/mol |
| Exact Mass | 654.37 |
| IUPAC Name | 1-[2-methyl-1,1-bis[[1-(trifluoromethyl)cyclohexyl]oxy]decoxy]-1-(trifluoromethyl)cyclohexane |
| SMILES | CCCCCCCCC(C)C(OC1(C(F)(F)F)CCCCC1)(OC1(C(F)(F)F)CCCCC1)OC1(C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C32H51F9O3/c1-3-4-5-6-7-11-18-25(2)29(42-26(30(33,34)35)19-12-8-13-20-26,43-27(31(36,37)38)21-14-9-15-22-27)44-28(32(39,40)41)23-16-10-17-24-28/h25H,3-24H2,1-2H3 |
| InChIKey | ZDYWCGQIQIYBPT-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.74 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|