C13H23F6N — CID 103311798
1,1,1-trifluoro-2-(trifluoromethyl)dodecan-3-amine (PubChem CID 103311798) has the molecular formula C13H23F6N and a molecular weight of 307.32 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(trifluoromethyl)dodecan-3-amine.
| Compound Name | 1,1,1-trifluoro-2-(trifluoromethyl)dodecan-3-amine |
|---|---|
| PubChem CID | 103311798 |
| Molecular Formula | C13H23F6N |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1,1,1-trifluoro-2-(trifluoromethyl)dodecan-3-amine |
| SMILES | CCCCCCCCCC(N)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H23F6N/c1-2-3-4-5-6-7-8-9-10(20)11(12(14,15)16)13(17,18)19/h10-11H,2-9,20H2,1H3 |
| InChIKey | VQPVZJGJTAHFLD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|