C6H3ClF9I — CID 71337308
6-chloro-1,1,1,2,2,3,3,4,4-nonafluoro-5-iodohexane (PubChem CID 71337308) has the molecular formula C6H3ClF9I and a molecular weight of 408.43 g/mol. Its IUPAC name is 6-chloro-1,1,1,2,2,3,3,4,4-nonafluoro-5-iodohexane.
| Compound Name | 6-chloro-1,1,1,2,2,3,3,4,4-nonafluoro-5-iodohexane |
|---|---|
| PubChem CID | 71337308 |
| Molecular Formula | C6H3ClF9I |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 407.88 |
| IUPAC Name | 6-chloro-1,1,1,2,2,3,3,4,4-nonafluoro-5-iodohexane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(I)CCl |
| InChI | InChI=1S/C6H3ClF9I/c7-1-2(17)3(8,9)4(10,11)5(12,13)6(14,15)16/h2H,1H2 |
| InChIKey | BDWUFWLLBYZWAP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|