C12H6F18I2O4S — CID 54102070
bis(3,3,4,4,5,5,6,6,6-nonafluoro-2-iodohexyl) sulfate (PubChem CID 54102070) has the molecular formula C12H6F18I2O4S and a molecular weight of 842.01 g/mol. Its IUPAC name is bis(3,3,4,4,5,5,6,6,6-nonafluoro-2-iodohexyl) sulfate.
| Compound Name | bis(3,3,4,4,5,5,6,6,6-nonafluoro-2-iodohexyl) sulfate |
|---|---|
| PubChem CID | 54102070 |
| Molecular Formula | C12H6F18I2O4S |
| Molecular Weight | 842.01 g/mol |
| Exact Mass | 841.78 |
| IUPAC Name | bis(3,3,4,4,5,5,6,6,6-nonafluoro-2-iodohexyl) sulfate |
| SMILES | O=S(=O)(OCC(I)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCC(I)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H6F18I2O4S/c13-5(14,7(17,18)9(21,22)11(25,26)27)3(31)1-35-37(33,34)36-2-4(32)6(15,16)8(19,20)10(23,24)12(28,29)30/h3-4H,1-2H2 |
| InChIKey | NBELKFUTWMNGNI-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.01 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|