C3H3ClF3IO3S — CID 98115622
(2R)-3-chlorosulfonyloxy-1,1,1-trifluoro-2-iodopropane (PubChem CID 98115622) has the molecular formula C3H3ClF3IO3S and a molecular weight of 338.47 g/mol. Its IUPAC name is (2R)-3-chlorosulfonyloxy-1,1,1-trifluoro-2-iodopropane.
| Compound Name | (2R)-3-chlorosulfonyloxy-1,1,1-trifluoro-2-iodopropane |
|---|---|
| PubChem CID | 98115622 |
| Molecular Formula | C3H3ClF3IO3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 337.85 |
| IUPAC Name | (2R)-3-chlorosulfonyloxy-1,1,1-trifluoro-2-iodopropane |
| SMILES | O=S(=O)(Cl)OC[C@@H](I)C(F)(F)F |
| InChI | InChI=1S/C3H3ClF3IO3S/c4-12(9,10)11-1-2(8)3(5,6)7/h2H,1H2/t2-/m1/s1 |
| InChIKey | MBMKXUMARAUYHE-UWTATZPHSA-N |
| XLogP | 1.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|