C4H2F8O5S2 — CID 87660281
1,2,2,2-tetrafluoroethylsulfonyl 1,2,2,2-tetrafluoroethanesulfonate (PubChem CID 87660281) has the molecular formula C4H2F8O5S2 and a molecular weight of 346.17 g/mol. Its IUPAC name is 1,2,2,2-tetrafluoroethylsulfonyl 1,2,2,2-tetrafluoroethanesulfonate.
| Compound Name | 1,2,2,2-tetrafluoroethylsulfonyl 1,2,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87660281 |
| Molecular Formula | C4H2F8O5S2 |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 345.92 |
| IUPAC Name | 1,2,2,2-tetrafluoroethylsulfonyl 1,2,2,2-tetrafluoroethanesulfonate |
| SMILES | O=S(=O)(OS(=O)(=O)C(F)C(F)(F)F)C(F)C(F)(F)F |
| InChI | InChI=1S/C4H2F8O5S2/c5-1(3(7,8)9)18(13,14)17-19(15,16)2(6)4(10,11)12/h1-2H |
| InChIKey | VJJRQQKOLYKJFQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |