C7H12F8O8S2 — CID 87127924
propane-1,3-diol;bis(1,2,2,2-tetrafluoroethanesulfonic acid) (PubChem CID 87127924) has the molecular formula C7H12F8O8S2 and a molecular weight of 440.28 g/mol. Its IUPAC name is propane-1,3-diol;bis(1,2,2,2-tetrafluoroethanesulfonic acid).
| Compound Name | propane-1,3-diol;bis(1,2,2,2-tetrafluoroethanesulfonic acid) |
|---|---|
| PubChem CID | 87127924 |
| Molecular Formula | C7H12F8O8S2 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | propane-1,3-diol;bis(1,2,2,2-tetrafluoroethanesulfonic acid) |
| SMILES | O=S(=O)(O)C(F)C(F)(F)F.O=S(=O)(O)C(F)C(F)(F)F.OCCCO |
| InChI | InChI=1S/C3H8O2.2C2H2F4O3S/c4-2-1-3-5;2*3-1(2(4,5)6)10(7,8)9/h4-5H,1-3H2;2*1H,(H,7,8,9) |
| InChIKey | FPTZYPQHUXRBQU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|