C8H2F16O7S2 — CID 87659826
[1,2,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethyl]sulfonyl 1,2,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate (PubChem CID 87659826) has the molecular formula C8H2F16O7S2 and a molecular weight of 578.20 g/mol. Its IUPAC name is [1,2,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethyl]sulfonyl 1,2,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate.
| Compound Name | [1,2,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethyl]sulfonyl 1,2,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
|---|---|
| PubChem CID | 87659826 |
| Molecular Formula | C8H2F16O7S2 |
| Molecular Weight | 578.20 g/mol |
| Exact Mass | 577.90 |
| IUPAC Name | [1,2,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethyl]sulfonyl 1,2,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
| SMILES | O=S(=O)(OS(=O)(=O)C(F)C(F)(F)OC(F)(F)C(F)(F)F)C(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H2F16O7S2/c9-1(3(11,12)29-7(21,22)5(15,16)17)32(25,26)31-33(27,28)2(10)4(13,14)30-8(23,24)6(18,19)20/h1-2H |
| InChIKey | KCLHTXXLNFQMGS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.20 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|