C8H6F12O6S2 — CID 87128316
1-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyloxy)ethyl 1,1,1,3,3,3-hexafluoropropane-2-sulfonate (PubChem CID 87128316) has the molecular formula C8H6F12O6S2 and a molecular weight of 490.24 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyloxy)ethyl 1,1,1,3,3,3-hexafluoropropane-2-sulfonate.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyloxy)ethyl 1,1,1,3,3,3-hexafluoropropane-2-sulfonate |
|---|---|
| PubChem CID | 87128316 |
| Molecular Formula | C8H6F12O6S2 |
| Molecular Weight | 490.24 g/mol |
| Exact Mass | 489.94 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyloxy)ethyl 1,1,1,3,3,3-hexafluoropropane-2-sulfonate |
| SMILES | CC(OS(=O)(=O)C(C(F)(F)F)C(F)(F)F)OS(=O)(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F12O6S2/c1-2(25-27(21,22)3(5(9,10)11)6(12,13)14)26-28(23,24)4(7(15,16)17)8(18,19)20/h2-4H,1H3 |
| InChIKey | ZSCURYMWSWSNAF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|