C5H7AgF6O6S2 — CID 159157127
silver;propan-2-yl trifluoromethanesulfonate;trifluoromethanesulfonate (PubChem CID 159157127) has the molecular formula C5H7AgF6O6S2 and a molecular weight of 449.10 g/mol. Its IUPAC name is silver;propan-2-yl trifluoromethanesulfonate;trifluoromethanesulfonate.
| Compound Name | silver;propan-2-yl trifluoromethanesulfonate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159157127 |
| Molecular Formula | C5H7AgF6O6S2 |
| Molecular Weight | 449.10 g/mol |
| Exact Mass | 447.86 |
| IUPAC Name | silver;propan-2-yl trifluoromethanesulfonate;trifluoromethanesulfonate |
| SMILES | CC(C)OS(=O)(=O)C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Ag+] |
| InChI | InChI=1S/C4H7F3O3S.CHF3O3S.Ag/c1-3(2)10-11(8,9)4(5,6)7;2-1(3,4)8(5,6)7;/h3H,1-2H3;(H,5,6,7);/q;;+1/p-1 |
| InChIKey | KKALZJQQUGMPKF-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.10 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|