C8H10F7N — CID 171229978
(4S)-1,1,1,2,2,3,3-heptafluorooct-7-en-4-amine (PubChem CID 171229978) has the molecular formula C8H10F7N and a molecular weight of 253.16 g/mol. Its IUPAC name is (4S)-1,1,1,2,2,3,3-heptafluorooct-7-en-4-amine.
| Compound Name | (4S)-1,1,1,2,2,3,3-heptafluorooct-7-en-4-amine |
|---|---|
| PubChem CID | 171229978 |
| Molecular Formula | C8H10F7N |
| Molecular Weight | 253.16 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | (4S)-1,1,1,2,2,3,3-heptafluorooct-7-en-4-amine |
| SMILES | C=CCC[C@H](N)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F7N/c1-2-3-4-5(16)6(9,10)7(11,12)8(13,14)15/h2,5H,1,3-4,16H2/t5-/m0/s1 |
| InChIKey | TXLBZSJKRJASLM-YFKPBYRVSA-N |
| XLogP | 3.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|