C6H6F7N — CID 171229946
(3S)-4,4,5,5,6,6,6-heptafluorohex-1-en-3-amine (PubChem CID 171229946) has the molecular formula C6H6F7N and a molecular weight of 225.11 g/mol. Its IUPAC name is (3S)-4,4,5,5,6,6,6-heptafluorohex-1-en-3-amine.
| Compound Name | (3S)-4,4,5,5,6,6,6-heptafluorohex-1-en-3-amine |
|---|---|
| PubChem CID | 171229946 |
| Molecular Formula | C6H6F7N |
| Molecular Weight | 225.11 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | (3S)-4,4,5,5,6,6,6-heptafluorohex-1-en-3-amine |
| SMILES | C=C[C@H](N)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H6F7N/c1-2-3(14)4(7,8)5(9,10)6(11,12)13/h2-3H,1,14H2/t3-/m0/s1 |
| InChIKey | NJMNAPSWDIYCKB-VKHMYHEASA-N |
| XLogP | 2.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.11 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|