C15H17F13 — CID 163735065
8-ethenyl-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-7,10-dimethylundecane (PubChem CID 163735065) has the molecular formula C15H17F13 and a molecular weight of 444.28 g/mol. Its IUPAC name is 8-ethenyl-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-7,10-dimethylundecane.
| Compound Name | 8-ethenyl-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-7,10-dimethylundecane |
|---|---|
| PubChem CID | 163735065 |
| Molecular Formula | C15H17F13 |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 8-ethenyl-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-7,10-dimethylundecane |
| SMILES | C=CC(CC(C)C)C(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H17F13/c1-5-9(6-7(2)3)8(4)10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h5,7-9H,1,6H2,2-4H3 |
| InChIKey | LCWUECKRVZCGNT-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|