About 1-bromohexane-1,6-diamine
1-bromohexane-1,6-diamine (PubChem CID 174353675) has the molecular formula C6H15BrN2
and a molecular weight of 195.10 g/mol. Its IUPAC name is 1-bromohexane-1,6-diamine.
Molecular Properties
| Compound Name | 1-bromohexane-1,6-diamine |
| PubChem CID | 174353675 |
| Molecular Formula | C6H15BrN2 |
| Molecular Weight | 195.10 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 1-bromohexane-1,6-diamine |
| SMILES | NCCCCCC(N)Br |
| InChI | InChI=1S/C6H15BrN2/c7-6(9)4-2-1-3-5-8/h6H,1-5,8-9H2 |
| InChIKey | XZFGVHGFZOVKCT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.10 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-bromohexane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromohexane-1,6-diamine?
The IUPAC name of 1-bromohexane-1,6-diamine (CID 174353675) is 1-bromohexane-1,6-diamine.
What is the SMILES notation for 1-bromohexane-1,6-diamine?
The canonical SMILES for 1-bromohexane-1,6-diamine is NCCCCCC(N)Br.
What is the InChIKey of 1-bromohexane-1,6-diamine?
The InChIKey is XZFGVHGFZOVKCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15BrN2/c7-6(9)4-2-1-3-5-8/h6H,1-5,8-9H2.
What are the key properties of 1-bromohexane-1,6-diamine?
1-bromohexane-1,6-diamine has a molecular weight of 195.10 g/mol, XLogP of 1.19, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromohexane-1,6-diamine is sourced from PubChem (CID 174353675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).