About 1-bromododecane-1,12-diamine
1-bromododecane-1,12-diamine (PubChem CID 175488635) has the molecular formula C12H27BrN2
and a molecular weight of 279.27 g/mol. Its IUPAC name is 1-bromododecane-1,12-diamine.
Molecular Properties
| Compound Name | 1-bromododecane-1,12-diamine |
| PubChem CID | 175488635 |
| Molecular Formula | C12H27BrN2 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 1-bromododecane-1,12-diamine |
| SMILES | NCCCCCCCCCCCC(N)Br |
| InChI | InChI=1S/C12H27BrN2/c13-12(15)10-8-6-4-2-1-3-5-7-9-11-14/h12H,1-11,14-15H2 |
| InChIKey | VECANIGDSVRMJK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-bromododecane-1,12-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromododecane-1,12-diamine?
The IUPAC name of 1-bromododecane-1,12-diamine (CID 175488635) is 1-bromododecane-1,12-diamine.
What is the SMILES notation for 1-bromododecane-1,12-diamine?
The canonical SMILES for 1-bromododecane-1,12-diamine is NCCCCCCCCCCCC(N)Br.
What is the InChIKey of 1-bromododecane-1,12-diamine?
The InChIKey is VECANIGDSVRMJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27BrN2/c13-12(15)10-8-6-4-2-1-3-5-7-9-11-14/h12H,1-11,14-15H2.
What are the key properties of 1-bromododecane-1,12-diamine?
1-bromododecane-1,12-diamine has a molecular weight of 279.27 g/mol, XLogP of 3.53, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromododecane-1,12-diamine is sourced from PubChem (CID 175488635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).