C5H8ClF6N — CID 171222694
(2S)-1,1,1,5,5,5-hexafluoropentan-2-amine;hydrochloride (PubChem CID 171222694) has the molecular formula C5H8ClF6N and a molecular weight of 231.57 g/mol. Its IUPAC name is (2S)-1,1,1,5,5,5-hexafluoropentan-2-amine;hydrochloride.
| Compound Name | (2S)-1,1,1,5,5,5-hexafluoropentan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 171222694 |
| Molecular Formula | C5H8ClF6N |
| Molecular Weight | 231.57 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | (2S)-1,1,1,5,5,5-hexafluoropentan-2-amine;hydrochloride |
| SMILES | Cl.N[C@@H](CCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H7F6N.ClH/c6-4(7,8)2-1-3(12)5(9,10)11;/h3H,1-2,12H2;1H/t3-;/m0./s1 |
| InChIKey | CEIRLVZERHUPSH-DFWYDOINSA-N |
| XLogP | 2.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.57 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |