C14H27NOS2 — CID 115387957
N-[(3-ethyl-1,4-dithian-2-yl)-(oxan-4-yl)methyl]ethanamine (PubChem CID 115387957) has the molecular formula C14H27NOS2 and a molecular weight of 289.51 g/mol. Its IUPAC name is N-[(3-ethyl-1,4-dithian-2-yl)-(oxan-4-yl)methyl]ethanamine.
| Compound Name | N-[(3-ethyl-1,4-dithian-2-yl)-(oxan-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 115387957 |
| Molecular Formula | C14H27NOS2 |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-[(3-ethyl-1,4-dithian-2-yl)-(oxan-4-yl)methyl]ethanamine |
| SMILES | CCNC(C1CCOCC1)C1SCCSC1CC |
| InChI | InChI=1S/C14H27NOS2/c1-3-12-14(18-10-9-17-12)13(15-4-2)11-5-7-16-8-6-11/h11-15H,3-10H2,1-2H3 |
| InChIKey | CSGMTEHCYMORID-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |