C9H16N2S2 — CID 105259884
1-(3-ethyl-1,4-dithian-2-yl)prop-2-ynylhydrazine (PubChem CID 105259884) has the molecular formula C9H16N2S2 and a molecular weight of 216.37 g/mol. Its IUPAC name is 1-(3-ethyl-1,4-dithian-2-yl)prop-2-ynylhydrazine.
| Compound Name | 1-(3-ethyl-1,4-dithian-2-yl)prop-2-ynylhydrazine |
|---|---|
| PubChem CID | 105259884 |
| Molecular Formula | C9H16N2S2 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 1-(3-ethyl-1,4-dithian-2-yl)prop-2-ynylhydrazine |
| SMILES | C#CC(NN)C1SCCSC1CC |
| InChI | InChI=1S/C9H16N2S2/c1-3-7(11-10)9-8(4-2)12-5-6-13-9/h1,7-9,11H,4-6,10H2,2H3 |
| InChIKey | URWJRWIVQBTXLQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|