C18H27N — CID 115849575
1-(6-bicyclo[3.1.0]hexanyl)-N-ethyl-4-phenylbutan-1-amine (PubChem CID 115849575) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-(6-bicyclo[3.1.0]hexanyl)-N-ethyl-4-phenylbutan-1-amine.
| Compound Name | 1-(6-bicyclo[3.1.0]hexanyl)-N-ethyl-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 115849575 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 1-(6-bicyclo[3.1.0]hexanyl)-N-ethyl-4-phenylbutan-1-amine |
| SMILES | CCNC(CCCc1ccccc1)C1C2CCCC21 |
| InChI | InChI=1S/C18H27N/c1-2-19-17(18-15-11-7-12-16(15)18)13-6-10-14-8-4-3-5-9-14/h3-5,8-9,15-19H,2,6-7,10-13H2,1H3 |
| InChIKey | WJXFTOCGUPILPY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |