About (1R)-1-(1,4-diazabicyclo[2.2.2]octan-2-yl)propan-1-amine
(1R)-1-(1,4-diazabicyclo[2.2.2]octan-2-yl)propan-1-amine (PubChem CID 104932147) has the molecular formula C9H19N3
and a molecular weight of 169.27 g/mol. Its IUPAC name is (1R)-1-(1,4-diazabicyclo[2.2.2]octan-2-yl)propan-1-amine.
Molecular Properties
| Compound Name | (1R)-1-(1,4-diazabicyclo[2.2.2]octan-2-yl)propan-1-amine |
| PubChem CID | 104932147 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | (1R)-1-(1,4-diazabicyclo[2.2.2]octan-2-yl)propan-1-amine |
| SMILES | CC[C@@H](N)C1CN2CCN1CC2 |
| InChI | InChI=1S/C9H19N3/c1-2-8(10)9-7-11-3-5-12(9)6-4-11/h8-9H,2-7,10H2,1H3/t8-,9?/m1/s1 |
| InChIKey | FMVCKXXCVQJBDQ-VEDVMXKPSA-N |
| XLogP | -0.28 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-(1,4-diazabicyclo[2.2.2]octan-2-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(1,4-diazabicyclo[2.2.2]octan-2-yl)propan-1-amine?
The IUPAC name of (1R)-1-(1,4-diazabicyclo[2.2.2]octan-2-yl)propan-1-amine (CID 104932147) is (1R)-1-(1,4-diazabicyclo[2.2.2]octan-2-yl)propan-1-amine.
What is the SMILES notation for (1R)-1-(1,4-diazabicyclo[2.2.2]octan-2-yl)propan-1-amine?
The canonical SMILES for (1R)-1-(1,4-diazabicyclo[2.2.2]octan-2-yl)propan-1-amine is CC[C@@H](N)C1CN2CCN1CC2.
What is the InChIKey of (1R)-1-(1,4-diazabicyclo[2.2.2]octan-2-yl)propan-1-amine?
The InChIKey is FMVCKXXCVQJBDQ-VEDVMXKPSA-N. The full InChI is InChI=1S/C9H19N3/c1-2-8(10)9-7-11-3-5-12(9)6-4-11/h8-9H,2-7,10H2,1H3/t8-,9?/m1/s1.
What are the key properties of (1R)-1-(1,4-diazabicyclo[2.2.2]octan-2-yl)propan-1-amine?
(1R)-1-(1,4-diazabicyclo[2.2.2]octan-2-yl)propan-1-amine has a molecular weight of 169.27 g/mol, XLogP of -0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(1,4-diazabicyclo[2.2.2]octan-2-yl)propan-1-amine is sourced from PubChem (CID 104932147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).