C14H19Cl2NOS — CID 79963248
2-(2,5-dichlorophenyl)-N-ethyl-1-(1,4-oxathian-2-yl)ethanamine (PubChem CID 79963248) has the molecular formula C14H19Cl2NOS and a molecular weight of 320.29 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-N-ethyl-1-(1,4-oxathian-2-yl)ethanamine.
| Compound Name | 2-(2,5-dichlorophenyl)-N-ethyl-1-(1,4-oxathian-2-yl)ethanamine |
|---|---|
| PubChem CID | 79963248 |
| Molecular Formula | C14H19Cl2NOS |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-N-ethyl-1-(1,4-oxathian-2-yl)ethanamine |
| SMILES | CCNC(Cc1cc(Cl)ccc1Cl)C1CSCCO1 |
| InChI | InChI=1S/C14H19Cl2NOS/c1-2-17-13(14-9-19-6-5-18-14)8-10-7-11(15)3-4-12(10)16/h3-4,7,13-14,17H,2,5-6,8-9H2,1H3 |
| InChIKey | CAGRPSASYFAOAI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |