C13H17Cl2NOS — CID 79962732
2-(2,4-dichlorophenyl)-N-methyl-1-(1,4-oxathian-2-yl)ethanamine (PubChem CID 79962732) has the molecular formula C13H17Cl2NOS and a molecular weight of 306.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-methyl-1-(1,4-oxathian-2-yl)ethanamine.
| Compound Name | 2-(2,4-dichlorophenyl)-N-methyl-1-(1,4-oxathian-2-yl)ethanamine |
|---|---|
| PubChem CID | 79962732 |
| Molecular Formula | C13H17Cl2NOS |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-methyl-1-(1,4-oxathian-2-yl)ethanamine |
| SMILES | CNC(Cc1ccc(Cl)cc1Cl)C1CSCCO1 |
| InChI | InChI=1S/C13H17Cl2NOS/c1-16-12(13-8-18-5-4-17-13)6-9-2-3-10(14)7-11(9)15/h2-3,7,12-13,16H,4-6,8H2,1H3 |
| InChIKey | QRNHJKWKGPIKOG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |