C12H14BrClO2S — CID 113471227
2-(4-bromo-2-chlorophenyl)-1-(1,4-oxathian-2-yl)ethanol (PubChem CID 113471227) has the molecular formula C12H14BrClO2S and a molecular weight of 337.67 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenyl)-1-(1,4-oxathian-2-yl)ethanol.
| Compound Name | 2-(4-bromo-2-chlorophenyl)-1-(1,4-oxathian-2-yl)ethanol |
|---|---|
| PubChem CID | 113471227 |
| Molecular Formula | C12H14BrClO2S |
| Molecular Weight | 337.67 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 2-(4-bromo-2-chlorophenyl)-1-(1,4-oxathian-2-yl)ethanol |
| SMILES | OC(Cc1ccc(Br)cc1Cl)C1CSCCO1 |
| InChI | InChI=1S/C12H14BrClO2S/c13-9-2-1-8(10(14)6-9)5-11(15)12-7-17-4-3-16-12/h1-2,6,11-12,15H,3-5,7H2 |
| InChIKey | BTFDFMROBXICPU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.67 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |