C15H20O2S — CID 79962796
2-(2,3-dihydro-1H-inden-5-yl)-1-(1,4-oxathian-2-yl)ethanol (PubChem CID 79962796) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yl)-1-(1,4-oxathian-2-yl)ethanol.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yl)-1-(1,4-oxathian-2-yl)ethanol |
|---|---|
| PubChem CID | 79962796 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yl)-1-(1,4-oxathian-2-yl)ethanol |
| SMILES | OC(Cc1ccc2c(c1)CCC2)C1CSCCO1 |
| InChI | InChI=1S/C15H20O2S/c16-14(15-10-18-7-6-17-15)9-11-4-5-12-2-1-3-13(12)8-11/h4-5,8,14-16H,1-3,6-7,9-10H2 |
| InChIKey | LBBIWOUKCJCTGR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |