C13H23N3OS — CID 79962860
N-[1,4-oxathian-2-yl-(1-propylimidazol-2-yl)methyl]ethanamine (PubChem CID 79962860) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is N-[1,4-oxathian-2-yl-(1-propylimidazol-2-yl)methyl]ethanamine.
| Compound Name | N-[1,4-oxathian-2-yl-(1-propylimidazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 79962860 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-[1,4-oxathian-2-yl-(1-propylimidazol-2-yl)methyl]ethanamine |
| SMILES | CCCn1ccnc1C(NCC)C1CSCCO1 |
| InChI | InChI=1S/C13H23N3OS/c1-3-6-16-7-5-15-13(16)12(14-4-2)11-10-18-9-8-17-11/h5,7,11-12,14H,3-4,6,8-10H2,1-2H3 |
| InChIKey | OKVRIUZFOJMUJA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |