C13H23N3S2 — CID 79965935
N-[1,4-dithian-2-yl-(1-propylimidazol-2-yl)methyl]ethanamine (PubChem CID 79965935) has the molecular formula C13H23N3S2 and a molecular weight of 285.48 g/mol. Its IUPAC name is N-[1,4-dithian-2-yl-(1-propylimidazol-2-yl)methyl]ethanamine.
| Compound Name | N-[1,4-dithian-2-yl-(1-propylimidazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 79965935 |
| Molecular Formula | C13H23N3S2 |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-[1,4-dithian-2-yl-(1-propylimidazol-2-yl)methyl]ethanamine |
| SMILES | CCCn1ccnc1C(NCC)C1CSCCS1 |
| InChI | InChI=1S/C13H23N3S2/c1-3-6-16-7-5-15-13(16)12(14-4-2)11-10-17-8-9-18-11/h5,7,11-12,14H,3-4,6,8-10H2,1-2H3 |
| InChIKey | YWDZCIHXSXVVRU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |