C16H23ClF3N3O5 — CID 159476494
5-chloro-7-(trifluoromethyl)-1,4-dihydroquinoxaline;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol (PubChem CID 159476494) has the molecular formula C16H23ClF3N3O5 and a molecular weight of 429.82 g/mol. Its IUPAC name is 5-chloro-7-(trifluoromethyl)-1,4-dihydroquinoxaline;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | 5-chloro-7-(trifluoromethyl)-1,4-dihydroquinoxaline;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 159476494 |
| Molecular Formula | C16H23ClF3N3O5 |
| Molecular Weight | 429.82 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 5-chloro-7-(trifluoromethyl)-1,4-dihydroquinoxaline;(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.FC(F)(F)c1cc(Cl)c2c(c1)NC=CN2 |
| InChI | InChI=1S/C9H6ClF3N2.C7H17NO5/c10-6-3-5(9(11,12)13)4-7-8(6)15-2-1-14-7;1-8-2-4(10)6(12)7(13)5(11)3-9/h1-4,14-15H;4-13H,2-3H2,1H3/t;4-,5+,6+,7+/m.0/s1 |
| InChIKey | LWLHNKJKYSRJNI-WZTVWXICSA-N |
| XLogP | 0.31 |
| TPSA | 137.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.82 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |