C16H17NO4 — CID 171270234
5-[(1S,2R)-1-amino-2-hydroxy-3-phenylpropyl]-2-hydroxybenzoic acid (PubChem CID 171270234) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is 5-[(1S,2R)-1-amino-2-hydroxy-3-phenylpropyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[(1S,2R)-1-amino-2-hydroxy-3-phenylpropyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 171270234 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 5-[(1S,2R)-1-amino-2-hydroxy-3-phenylpropyl]-2-hydroxybenzoic acid |
| SMILES | N[C@@H](c1ccc(O)c(C(=O)O)c1)[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C16H17NO4/c17-15(14(19)8-10-4-2-1-3-5-10)11-6-7-13(18)12(9-11)16(20)21/h1-7,9,14-15,18-19H,8,17H2,(H,20,21)/t14-,15+/m1/s1 |
| InChIKey | LICCCVBAVOLCEJ-CABCVRRESA-N |
| XLogP | 1.69 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |