C11H16Cl2N2O3 — CID 171258788
2-[(1R)-1-amino-2,2-dimethylpropyl]-6-chloro-3-nitrophenol;hydrochloride (PubChem CID 171258788) has the molecular formula C11H16Cl2N2O3 and a molecular weight of 295.17 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2-dimethylpropyl]-6-chloro-3-nitrophenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-2,2-dimethylpropyl]-6-chloro-3-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171258788 |
| Molecular Formula | C11H16Cl2N2O3 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-[(1R)-1-amino-2,2-dimethylpropyl]-6-chloro-3-nitrophenol;hydrochloride |
| SMILES | CC(C)(C)[C@@H](N)c1c([N+](=O)[O-])ccc(Cl)c1O.Cl |
| InChI | InChI=1S/C11H15ClN2O3.ClH/c1-11(2,3)10(13)8-7(14(16)17)5-4-6(12)9(8)15;/h4-5,10,15H,13H2,1-3H3;1H/t10-;/m0./s1 |
| InChIKey | VKDOIENUWQXCOW-PPHPATTJSA-N |
| XLogP | 3.42 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|