C8H8Cl2N2O3 — CID 66515503
(2R)-2-amino-2-(2,6-dichloro-3-nitrophenyl)ethanol (PubChem CID 66515503) has the molecular formula C8H8Cl2N2O3 and a molecular weight of 251.07 g/mol. Its IUPAC name is (2R)-2-amino-2-(2,6-dichloro-3-nitrophenyl)ethanol.
| Compound Name | (2R)-2-amino-2-(2,6-dichloro-3-nitrophenyl)ethanol |
|---|---|
| PubChem CID | 66515503 |
| Molecular Formula | C8H8Cl2N2O3 |
| Molecular Weight | 251.07 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | (2R)-2-amino-2-(2,6-dichloro-3-nitrophenyl)ethanol |
| SMILES | N[C@@H](CO)c1c(Cl)ccc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C8H8Cl2N2O3/c9-4-1-2-6(12(14)15)8(10)7(4)5(11)3-13/h1-2,5,13H,3,11H2/t5-/m0/s1 |
| InChIKey | XGKWFDMNTPLRSE-YFKPBYRVSA-N |
| XLogP | 1.89 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.07 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|