C8H8Cl2F2N2O3 — CID 171258754
2-[(1S)-1-amino-2,2-difluoroethyl]-6-chloro-3-nitrophenol;hydrochloride (PubChem CID 171258754) has the molecular formula C8H8Cl2F2N2O3 and a molecular weight of 289.06 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2,2-difluoroethyl]-6-chloro-3-nitrophenol;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-2,2-difluoroethyl]-6-chloro-3-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171258754 |
| Molecular Formula | C8H8Cl2F2N2O3 |
| Molecular Weight | 289.06 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 2-[(1S)-1-amino-2,2-difluoroethyl]-6-chloro-3-nitrophenol;hydrochloride |
| SMILES | Cl.N[C@@H](c1c([N+](=O)[O-])ccc(Cl)c1O)C(F)F |
| InChI | InChI=1S/C8H7ClF2N2O3.ClH/c9-3-1-2-4(13(15)16)5(7(3)14)6(12)8(10)11;/h1-2,6,8,14H,12H2;1H/t6-;/m0./s1 |
| InChIKey | KRJUTOMQKMCWPL-RGMNGODLSA-N |
| XLogP | 2.64 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.06 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|