C9H11FN2O3 — CID 131613871
2-[(1S)-1-amino-2-fluoroethyl]-6-methyl-3-nitrophenol (PubChem CID 131613871) has the molecular formula C9H11FN2O3 and a molecular weight of 214.20 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2-fluoroethyl]-6-methyl-3-nitrophenol.
| Compound Name | 2-[(1S)-1-amino-2-fluoroethyl]-6-methyl-3-nitrophenol |
|---|---|
| PubChem CID | 131613871 |
| Molecular Formula | C9H11FN2O3 |
| Molecular Weight | 214.20 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-[(1S)-1-amino-2-fluoroethyl]-6-methyl-3-nitrophenol |
| SMILES | Cc1ccc([N+](=O)[O-])c([C@H](N)CF)c1O |
| InChI | InChI=1S/C9H11FN2O3/c1-5-2-3-7(12(14)15)8(9(5)13)6(11)4-10/h2-3,6,13H,4,11H2,1H3/t6-/m1/s1 |
| InChIKey | YWJKXDGVVCJBCR-ZCFIWIBFSA-N |
| XLogP | 1.58 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|