C17H22BrN3O — CID 171301412
4-bromo-3-[(R)-cyclopentyl(piperazin-1-yl)methyl]-2-hydroxybenzonitrile (PubChem CID 171301412) has the molecular formula C17H22BrN3O and a molecular weight of 364.29 g/mol. Its IUPAC name is 4-bromo-3-[(R)-cyclopentyl(piperazin-1-yl)methyl]-2-hydroxybenzonitrile.
| Compound Name | 4-bromo-3-[(R)-cyclopentyl(piperazin-1-yl)methyl]-2-hydroxybenzonitrile |
|---|---|
| PubChem CID | 171301412 |
| Molecular Formula | C17H22BrN3O |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 4-bromo-3-[(R)-cyclopentyl(piperazin-1-yl)methyl]-2-hydroxybenzonitrile |
| SMILES | N#Cc1ccc(Br)c([C@@H](C2CCCC2)N2CCNCC2)c1O |
| InChI | InChI=1S/C17H22BrN3O/c18-14-6-5-13(11-19)17(22)15(14)16(12-3-1-2-4-12)21-9-7-20-8-10-21/h5-6,12,16,20,22H,1-4,7-10H2/t16-/m1/s1 |
| InChIKey | NMKTZITXZKMXBX-MRXNPFEDSA-N |
| XLogP | 3.16 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|