C15H18BrN3O — CID 171298926
4-bromo-2-hydroxy-3-[(1S)-1-piperazin-1-ylbut-3-enyl]benzonitrile (PubChem CID 171298926) has the molecular formula C15H18BrN3O and a molecular weight of 336.23 g/mol. Its IUPAC name is 4-bromo-2-hydroxy-3-[(1S)-1-piperazin-1-ylbut-3-enyl]benzonitrile.
| Compound Name | 4-bromo-2-hydroxy-3-[(1S)-1-piperazin-1-ylbut-3-enyl]benzonitrile |
|---|---|
| PubChem CID | 171298926 |
| Molecular Formula | C15H18BrN3O |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 4-bromo-2-hydroxy-3-[(1S)-1-piperazin-1-ylbut-3-enyl]benzonitrile |
| SMILES | C=CC[C@@H](c1c(Br)ccc(C#N)c1O)N1CCNCC1 |
| InChI | InChI=1S/C15H18BrN3O/c1-2-3-13(19-8-6-18-7-9-19)14-12(16)5-4-11(10-17)15(14)20/h2,4-5,13,18,20H,1,3,6-9H2/t13-/m0/s1 |
| InChIKey | OGRVQVISNGINLV-ZDUSSCGKSA-N |
| XLogP | 2.55 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|