C12H15F2NO2 — CID 171256503
2-[(R)-amino(oxan-4-yl)methyl]-3,6-difluorophenol (PubChem CID 171256503) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is 2-[(R)-amino(oxan-4-yl)methyl]-3,6-difluorophenol.
| Compound Name | 2-[(R)-amino(oxan-4-yl)methyl]-3,6-difluorophenol |
|---|---|
| PubChem CID | 171256503 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-[(R)-amino(oxan-4-yl)methyl]-3,6-difluorophenol |
| SMILES | N[C@@H](c1c(F)ccc(F)c1O)C1CCOCC1 |
| InChI | InChI=1S/C12H15F2NO2/c13-8-1-2-9(14)12(16)10(8)11(15)7-3-5-17-6-4-7/h1-2,7,11,16H,3-6,15H2/t11-/m1/s1 |
| InChIKey | AJECAJDYICDGAC-LLVKDONJSA-N |
| XLogP | 2.10 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|