C12H15Cl2F2NO — CID 171242784
(S)-(2-chloro-3,6-difluorophenyl)-(oxan-4-yl)methanamine;hydrochloride (PubChem CID 171242784) has the molecular formula C12H15Cl2F2NO and a molecular weight of 298.16 g/mol. Its IUPAC name is (S)-(2-chloro-3,6-difluorophenyl)-(oxan-4-yl)methanamine;hydrochloride.
| Compound Name | (S)-(2-chloro-3,6-difluorophenyl)-(oxan-4-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171242784 |
| Molecular Formula | C12H15Cl2F2NO |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | (S)-(2-chloro-3,6-difluorophenyl)-(oxan-4-yl)methanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1c(F)ccc(F)c1Cl)C1CCOCC1 |
| InChI | InChI=1S/C12H14ClF2NO.ClH/c13-11-9(15)2-1-8(14)10(11)12(16)7-3-5-17-6-4-7;/h1-2,7,12H,3-6,16H2;1H/t12-;/m0./s1 |
| InChIKey | IOVNDZYTDDDHMN-YDALLXLXSA-N |
| XLogP | 3.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|