C10H11FN2O2 — CID 131455421
2-[(1S)-1-amino-2-fluoroethyl]-3-hydroxy-4-methoxybenzonitrile (PubChem CID 131455421) has the molecular formula C10H11FN2O2 and a molecular weight of 210.21 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2-fluoroethyl]-3-hydroxy-4-methoxybenzonitrile.
| Compound Name | 2-[(1S)-1-amino-2-fluoroethyl]-3-hydroxy-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 131455421 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 2-[(1S)-1-amino-2-fluoroethyl]-3-hydroxy-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)c([C@H](N)CF)c1O |
| InChI | InChI=1S/C10H11FN2O2/c1-15-8-3-2-6(5-12)9(10(8)14)7(13)4-11/h2-3,7,14H,4,13H2,1H3/t7-/m1/s1 |
| InChIKey | ZRKYCDOHWLXSSP-SSDOTTSWSA-N |
| XLogP | 1.24 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|