C13H16ClFN2O4 — CID 171258396
ethyl (3S)-3-amino-3-(6-cyano-2-hydroxy-3-methoxyphenyl)-2-fluoropropanoate;hydrochloride (PubChem CID 171258396) has the molecular formula C13H16ClFN2O4 and a molecular weight of 318.73 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(6-cyano-2-hydroxy-3-methoxyphenyl)-2-fluoropropanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(6-cyano-2-hydroxy-3-methoxyphenyl)-2-fluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 171258396 |
| Molecular Formula | C13H16ClFN2O4 |
| Molecular Weight | 318.73 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | ethyl (3S)-3-amino-3-(6-cyano-2-hydroxy-3-methoxyphenyl)-2-fluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1c(C#N)ccc(OC)c1O.Cl |
| InChI | InChI=1S/C13H15FN2O4.ClH/c1-3-20-13(18)10(14)11(16)9-7(6-15)4-5-8(19-2)12(9)17;/h4-5,10-11,17H,3,16H2,1-2H3;1H/t10?,11-;/m0./s1 |
| InChIKey | FCMHUTLIUYDTBO-GQNCZFCYSA-N |
| XLogP | 1.60 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.73 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|