About CID 66699527
CID 66699527 (PubChem CID 66699527) has the molecular formula C22H28NO3Si
and a molecular weight of 382.56 g/mol.
Molecular Properties
| Compound Name | CID 66699527 |
| PubChem CID | 66699527 |
| Molecular Formula | C22H28NO3Si |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | — |
| SMILES | COc1ccc(C(O)c2ccc(C(O[Si](C)C)C(C)(C)C)cc2)cc1C#N |
| InChI | InChI=1S/C22H28NO3Si/c1-22(2,3)21(26-27(5)6)16-9-7-15(8-10-16)20(24)17-11-12-19(25-4)18(13-17)14-23/h7-13,20-21,24H,1-6H3 |
| InChIKey | SUPABOPVVAATIB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66699527 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66699527?
The IUPAC name of CID 66699527 (CID 66699527) is not available.
What is the SMILES notation for CID 66699527?
The canonical SMILES for CID 66699527 is COc1ccc(C(O)c2ccc(C(O[Si](C)C)C(C)(C)C)cc2)cc1C#N.
What is the InChIKey of CID 66699527?
The InChIKey is SUPABOPVVAATIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28NO3Si/c1-22(2,3)21(26-27(5)6)16-9-7-15(8-10-16)20(24)17-11-12-19(25-4)18(13-17)14-23/h7-13,20-21,24H,1-6H3.
What are the key properties of CID 66699527?
CID 66699527 has a molecular weight of 382.56 g/mol, XLogP of 5.00, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66699527 is sourced from PubChem (CID 66699527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).