About CID 22996193
CID 22996193 (PubChem CID 22996193) has the molecular formula C16H24NO2Si
and a molecular weight of 290.46 g/mol.
Molecular Properties
| Compound Name | CID 22996193 |
| PubChem CID | 22996193 |
| Molecular Formula | C16H24NO2Si |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | — |
| SMILES | COCc1cc(C#N)cc(C(O[Si](C)C)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H24NO2Si/c1-16(2,3)15(19-20(5)6)14-8-12(10-17)7-13(9-14)11-18-4/h7-9,15H,11H2,1-6H3 |
| InChIKey | GUNLEGLWHIAUND-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22996193 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22996193?
The IUPAC name of CID 22996193 (CID 22996193) is not available.
What is the SMILES notation for CID 22996193?
The canonical SMILES for CID 22996193 is COCc1cc(C#N)cc(C(O[Si](C)C)C(C)(C)C)c1.
What is the InChIKey of CID 22996193?
The InChIKey is GUNLEGLWHIAUND-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24NO2Si/c1-16(2,3)15(19-20(5)6)14-8-12(10-17)7-13(9-14)11-18-4/h7-9,15H,11H2,1-6H3.
What are the key properties of CID 22996193?
CID 22996193 has a molecular weight of 290.46 g/mol, XLogP of 4.06, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22996193 is sourced from PubChem (CID 22996193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).