C13H17F3N2O4 — CID 172757752
benzyl N-[(2S)-2-aminopropyl]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 172757752) has the molecular formula C13H17F3N2O4 and a molecular weight of 322.28 g/mol. Its IUPAC name is benzyl N-[(2S)-2-aminopropyl]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | benzyl N-[(2S)-2-aminopropyl]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 172757752 |
| Molecular Formula | C13H17F3N2O4 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | benzyl N-[(2S)-2-aminopropyl]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | C[C@H](N)CNC(=O)OCc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H16N2O2.C2HF3O2/c1-9(12)7-13-11(14)15-8-10-5-3-2-4-6-10;3-2(4,5)1(6)7/h2-6,9H,7-8,12H2,1H3,(H,13,14);(H,6,7)/t9-;/m0./s1 |
| InChIKey | LGKSPWNGLREBNS-FVGYRXGTSA-N |
| XLogP | 1.89 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |