C23H28FNO6 — CID 18625854
methyl 2-(4-fluorophenoxy)-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]propanoate (PubChem CID 18625854) has the molecular formula C23H28FNO6 and a molecular weight of 433.48 g/mol. Its IUPAC name is methyl 2-(4-fluorophenoxy)-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]propanoate.
| Compound Name | methyl 2-(4-fluorophenoxy)-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 18625854 |
| Molecular Formula | C23H28FNO6 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | methyl 2-(4-fluorophenoxy)-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCNC(=O)OC(C)(C)C)cc1)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C23H28FNO6/c1-23(2,3)31-22(27)25-13-14-29-18-9-5-16(6-10-18)15-20(21(26)28-4)30-19-11-7-17(24)8-12-19/h5-12,20H,13-15H2,1-4H3,(H,25,27) |
| InChIKey | OPIHKOBCEDXCKU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|