C18H28N4O5 — CID 141366861
tert-butyl N-[3-[4-[[(3S)-3,4-diamino-4-oxobutanoyl]amino]phenoxy]propyl]carbamate (PubChem CID 141366861) has the molecular formula C18H28N4O5 and a molecular weight of 380.45 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[[(3S)-3,4-diamino-4-oxobutanoyl]amino]phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[[(3S)-3,4-diamino-4-oxobutanoyl]amino]phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 141366861 |
| Molecular Formula | C18H28N4O5 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | tert-butyl N-[3-[4-[[(3S)-3,4-diamino-4-oxobutanoyl]amino]phenoxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccc(NC(=O)C[C@H](N)C(N)=O)cc1 |
| InChI | InChI=1S/C18H28N4O5/c1-18(2,3)27-17(25)21-9-4-10-26-13-7-5-12(6-8-13)22-15(23)11-14(19)16(20)24/h5-8,14H,4,9-11,19H2,1-3H3,(H2,20,24)(H,21,25)(H,22,23)/t14-/m0/s1 |
| InChIKey | GLKBLNKXSPHIHB-AWEZNQCLSA-N |
| XLogP | 1.12 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|