C25H35N5O7 — CID 175482220
(2S)-5-amino-2-[[6-[(3-ethynylphenyl)carbamoylamino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]-5-oxopentanoic acid (PubChem CID 175482220) has the molecular formula C25H35N5O7 and a molecular weight of 517.58 g/mol. Its IUPAC name is (2S)-5-amino-2-[[6-[(3-ethynylphenyl)carbamoylamino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[6-[(3-ethynylphenyl)carbamoylamino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175482220 |
| Molecular Formula | C25H35N5O7 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | (2S)-5-amino-2-[[6-[(3-ethynylphenyl)carbamoylamino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]-5-oxopentanoic acid |
| SMILES | C#Cc1cccc(NC(=O)NCCCCC(NC(=O)N[C@@H](CCC(N)=O)C(=O)O)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C25H35N5O7/c1-5-16-9-8-10-17(15-16)28-23(35)27-14-7-6-11-19(22(34)37-25(2,3)4)30-24(36)29-18(21(32)33)12-13-20(26)31/h1,8-10,15,18-19H,6-7,11-14H2,2-4H3,(H2,26,31)(H,32,33)(H2,27,28,35)(H2,29,30,36)/t18-,19?/m0/s1 |
| InChIKey | YVUBLLJMTFAKMB-OYKVQYDMSA-N |
| XLogP | 1.69 |
| TPSA | 188.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|